CAS 6971-74-0 appears in our catalog under these names: N-Tosylbenzamide, 95%, N-Tosylbenzamide, 95-<97%, N–Tosylbenzamide, Benzamide, N-[(4-methylphenyl)sulfonyl]-, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 50g, 100g, 200g, 300g.
N-(4-methylphenyl)sulfonylbenzamide (CAS 6971-74-0) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: N-(4-methylphenyl)sulfonylbenzamide. InChIKey: SGJFNRQZMRIAJP-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | N-(4-methylphenyl)sulfonylbenzamide |
| InChIKey | SGJFNRQZMRIAJP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)