CAS 2570189-98-7 appears in our catalog under these names: 4-Hydroxy-5-[(4-methoxyphenyl)methyl]-4H-thieno[2,3-c]pyrrol-6-one, 98%, 4-Hydroxy-5-(4-methoxybenzyl)-4,5-dihydro-6H-thieno(2,3-c)pyrrol-6-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-hydroxy-5-[(4-methoxyphenyl)methyl]-4H-thieno[2,3-c]pyrrol-6-one (CAS 2570189-98-7) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 4-hydroxy-5-[(4-methoxyphenyl)methyl]-4H-thieno[2,3-c]pyrrol-6-one. InChIKey: VEMILAOVVCKGEV-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 4-hydroxy-5-[(4-methoxyphenyl)methyl]-4H-thieno[2,3-c]pyrrol-6-one |
| InChIKey | VEMILAOVVCKGEV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(C3=C(C2=O)SC=C3)O |
Computed by PubChem (NCBI)