CAS 18518-46-2 is the registry number for 1-(Phenylsulfonyl)-1,5,6,7-tetrahydro-4H-indol-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-one (CAS 18518-46-2) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-one. InChIKey: FQSIIHZPMZXMNL-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-one |
| InChIKey | FQSIIHZPMZXMNL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CN2S(=O)(=O)C3=CC=CC=C3)C(=O)C1 |
Computed by PubChem (NCBI)