CAS 63160-12-3 appears in our catalog under these names: 3–Phenyl–2–tosyl–1,2–oxaziridine, 3-Phenyl-2-tosyl-1,2-oxaziridine, 95%, 3-Phenyl-2-tosyl-1,2-oxaziridine, 96%, 3-Phenyl-2-tosyl-1,2-oxaziridine, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 25g, 10g, 5g, 1g.
2-(4-methylphenyl)sulfonyl-3-phenyloxaziridine (CAS 63160-12-3) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyl-3-phenyloxaziridine. InChIKey: SYTQRZCKINWJKR-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyl-3-phenyloxaziridine |
| InChIKey | SYTQRZCKINWJKR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)