Products 1803252-71-2
CAS 1803252-71-2 appears in our catalog under these names: Malonyl-L-carnitine-(N-methyl-d3) lithium salt, MALONYL-L-CARNITINE-(N-METHYL-D3) LITHIU. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
(3R)-3-(2-carboxyacetyl)oxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate (CAS 1803252-71-2) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 250.26 g/mol. IUPAC name: (3R)-3-(2-carboxyacetyl)oxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate. InChIKey: ZGNBLKBZJBJFDG-ISLPBHIQSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 250.26 g/mol |
| IUPAC name | (3R)-3-(2-carboxyacetyl)oxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate |
| InChIKey | ZGNBLKBZJBJFDG-ISLPBHIQSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CC(=O)O |
Computed by PubChem (NCBI)