Products 1803560-78-2
CAS 1803560-78-2 is the registry number for 2-(2,6-Difluorophenyl)-2-(methylamino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(2,6-difluorophenyl)-2-(methylamino)acetic acid;hydrochloride (CAS 1803560-78-2) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-2-(methylamino)acetic acid;hydrochloride. InChIKey: SKUAAZIJPYDAEY-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-2-(methylamino)acetic acid;hydrochloride |
| InChIKey | SKUAAZIJPYDAEY-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C=CC=C1F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)