Products 1803581-03-4
CAS 1803581-03-4 is the registry number for 3-(2-Aminoethyl)-1,3-diazaspiro(4.4)nonane-2,4-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-aminoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride (CAS 1803581-03-4) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: 3-(2-aminoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride. InChIKey: XBTSQPARSREZFC-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride |
| InChIKey | XBTSQPARSREZFC-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)N(C(=O)N2)CCN.Cl |
Computed by PubChem (NCBI)