CAS 1803581-90-9 appears in our catalog under these names: Methyl 5-formyl-1,2-dimethyl-1H-pyrrole-3-carboxylate, 95%, Methyl 5-formyl-1,2-dimethyl-1H-pyrrole-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 5-formyl-1,2-dimethylpyrrole-3-carboxylate (CAS 1803581-90-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 5-formyl-1,2-dimethylpyrrole-3-carboxylate. InChIKey: YGNOHNHMCYGZMX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl 5-formyl-1,2-dimethylpyrrole-3-carboxylate |
| InChIKey | YGNOHNHMCYGZMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1C)C=O)C(=O)OC |
Computed by PubChem (NCBI)