CAS 1803582-13-9 is the registry number for 2,6-Difluoro-3-methyl-5-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,6-difluoro-3-methyl-5-nitrobenzoic acid (CAS 1803582-13-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,6-difluoro-3-methyl-5-nitrobenzoic acid. InChIKey: IWBHXFCZDSPONS-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2,6-difluoro-3-methyl-5-nitrobenzoic acid |
| InChIKey | IWBHXFCZDSPONS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1F)C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)