Products 1803582-13-9

CAS 1803582-13-9 is the registry number for 2,6-Difluoro-3-methyl-5-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-3-methyl-5-nitrobenzoic acid (CAS 1803582-13-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,6-difluoro-3-methyl-5-nitrobenzoic acid. InChIKey: IWBHXFCZDSPONS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F2NO4
Molecular weight217.13 g/mol
IUPAC name2,6-difluoro-3-methyl-5-nitrobenzoic acid
InChIKeyIWBHXFCZDSPONS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1F)C(=O)O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)