Products 1803583-75-6
CAS 1803583-75-6 is the registry number for 5-(5-Methylfuran-2-yl)pyrazin-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(5-methylfuran-2-yl)-1H-pyrazin-2-one (CAS 1803583-75-6) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-(5-methylfuran-2-yl)-1H-pyrazin-2-one. InChIKey: BIGDSEOFQJMJRI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-(5-methylfuran-2-yl)-1H-pyrazin-2-one |
| InChIKey | BIGDSEOFQJMJRI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=CNC(=O)C=N2 |
Computed by PubChem (NCBI)