CAS 1803584-55-5 is the registry number for Methyl 2-amino-2-(4-fluorophenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-2-(4-fluorophenyl)propanoate;hydrochloride (CAS 1803584-55-5) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl 2-amino-2-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: QEJZWMBVOPBZQV-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl 2-amino-2-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | QEJZWMBVOPBZQV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)F)(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)