CAS 1803592-87-1 appears in our catalog under these names: Dofetilide Impurity 10, Methyl(2-(2-nitrophenyl)ethyl)amine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
N-methyl-2-(2-nitrophenyl)ethanamine;hydrochloride (CAS 1803592-87-1) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: N-methyl-2-(2-nitrophenyl)ethanamine;hydrochloride. InChIKey: RVMFBGBCWPAMMJ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | N-methyl-2-(2-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | RVMFBGBCWPAMMJ-UHFFFAOYSA-N |
| SMILES | CNCCC1=CC=CC=C1[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)