Products 1803599-69-0
CAS 1803599-69-0 is the registry number for 2-(3,4-Dichlorophenoxy)-N-methylbutanamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(3,4-dichlorophenoxy)-N-methylbutanamide (CAS 1803599-69-0) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: 2-(3,4-dichlorophenoxy)-N-methylbutanamide. InChIKey: CWZMYVACWFQQKV-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)-N-methylbutanamide |
| InChIKey | CWZMYVACWFQQKV-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)NC)OC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)