Products 1803752-61-5

CAS 1803752-61-5 is the registry number for 3-Cyano-4-fluoro-5-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-cyano-4-fluoro-5-methylbenzoic acid (CAS 1803752-61-5) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 3-cyano-4-fluoro-5-methylbenzoic acid. InChIKey: CYXGZXNBBNCIMW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6FNO2
Molecular weight179.15 g/mol
IUPAC name3-cyano-4-fluoro-5-methylbenzoic acid
InChIKeyCYXGZXNBBNCIMW-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)C#N)C(=O)O

Computed by PubChem (NCBI)