CAS 1803814-86-9 is the registry number for 1,2-Dichloro-4-methyl-3-nitrobenzene, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,2-dichloro-4-methyl-3-nitrobenzene (CAS 1803814-86-9) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1,2-dichloro-4-methyl-3-nitrobenzene. InChIKey: GKWQFXNJOQXMLH-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1,2-dichloro-4-methyl-3-nitrobenzene |
| InChIKey | GKWQFXNJOQXMLH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)