Products 1804046-57-8
CAS 1804046-57-8 appears in our catalog under these names: 5-Fluoro-2-(trifluoromethyl)nicotinic acid 97%, 5-Fluoro-2-(trifluoromethyl)nicotinic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg, 1g, 50mg.
5-fluoro-2-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1804046-57-8) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: UVAQJZPGOCLETG-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | UVAQJZPGOCLETG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(F)(F)F)F |
Computed by PubChem (NCBI)