CAS 1804416-86-1 is the registry number for 3,4-Dibromo-2-fluorobenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g.
3,4-dibromo-2-fluorobenzoic acid (CAS 1804416-86-1) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,4-dibromo-2-fluorobenzoic acid. InChIKey: OMZJORHFKMXMGP-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,4-dibromo-2-fluorobenzoic acid |
| InChIKey | OMZJORHFKMXMGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)Br)Br |
Computed by PubChem (NCBI)