CAS 289039-48-1 appears in our catalog under these names: 4,5-Dibromo-2-fluorobenzoic Acid, 4,5–Dibromo–2–fluorobenzoic acid, 4,5-Dibromo-2-fluorobenzoic acid 95%, 4,5-Dibromo-2-fluorobenzoic acid, 95%, 95%, 4,5-Dibromo-2-fluorobenzoic acid, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
4,5-dibromo-2-fluorobenzoic acid (CAS 289039-48-1) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 4,5-dibromo-2-fluorobenzoic acid. InChIKey: WQYCLZJOUMEOCB-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 4,5-dibromo-2-fluorobenzoic acid |
| InChIKey | WQYCLZJOUMEOCB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)F)C(=O)O |
Computed by PubChem (NCBI)