Products 1804516-11-7
CAS 1804516-11-7 is the registry number for 2,3-Difluoro-5-nitrobenzodifluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(difluoromethyl)-2,3-difluoro-5-nitrobenzene (CAS 1804516-11-7) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-(difluoromethyl)-2,3-difluoro-5-nitrobenzene. InChIKey: PGOPPGBFGSXUDU-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-(difluoromethyl)-2,3-difluoro-5-nitrobenzene |
| InChIKey | PGOPPGBFGSXUDU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)