Products 1804688-56-9
CAS 1804688-56-9 is the registry number for 4-(Difluoromethyl)-6-methoxynicotinaldehyde, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(difluoromethyl)-6-methoxypyridine-3-carbaldehyde (CAS 1804688-56-9) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 4-(difluoromethyl)-6-methoxypyridine-3-carbaldehyde. InChIKey: RKBVPZCFYVWAGM-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 4-(difluoromethyl)-6-methoxypyridine-3-carbaldehyde |
| InChIKey | RKBVPZCFYVWAGM-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C(F)F)C=O |
Computed by PubChem (NCBI)