Products 1804881-22-8
CAS 1804881-22-8 is the registry number for 1-(3-chloro-2-fluoro-4-methylphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(3-chloro-2-fluoro-4-methylphenyl)ethanone (CAS 1804881-22-8) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(3-chloro-2-fluoro-4-methylphenyl)ethanone. InChIKey: FXTIUYVFAXQCDO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(3-chloro-2-fluoro-4-methylphenyl)ethanone |
| InChIKey | FXTIUYVFAXQCDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)C)F)Cl |
Computed by PubChem (NCBI)