Products 1805303-98-3
CAS 1805303-98-3 is the registry number for 6-Chloro-3-(difluoromethyl)-2-pyridinecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
6-chloro-3-(difluoromethyl)pyridine-2-carboxylic acid (CAS 1805303-98-3) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 6-chloro-3-(difluoromethyl)pyridine-2-carboxylic acid. InChIKey: UJIZIWLSDJAEKW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 6-chloro-3-(difluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | UJIZIWLSDJAEKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)