Products 1805578-60-2
CAS 1805578-60-2 is the registry number for 1-Bromo-2,4-dichloro-3-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2,4-dichloro-3-nitrobenzene (CAS 1805578-60-2) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 1-bromo-2,4-dichloro-3-nitrobenzene. InChIKey: CIMPUCQBTXFSHT-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 1-bromo-2,4-dichloro-3-nitrobenzene |
| InChIKey | CIMPUCQBTXFSHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)