Products 1806288-82-3

CAS 1806288-82-3 is the registry number for 3-Cyano-2-methoxy-6-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-cyano-2-methoxy-6-methylbenzoic acid (CAS 1806288-82-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 3-cyano-2-methoxy-6-methylbenzoic acid. InChIKey: NLQPORCLTVPYIS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO3
Molecular weight191.18 g/mol
IUPAC name3-cyano-2-methoxy-6-methylbenzoic acid
InChIKeyNLQPORCLTVPYIS-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)C#N)OC)C(=O)O

Computed by PubChem (NCBI)