Products 1807142-97-7
CAS 1807142-97-7 is the registry number for 4-cyano-2-fluoro-5-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
4-cyano-2-fluoro-5-methylbenzoic acid (CAS 1807142-97-7) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-cyano-2-fluoro-5-methylbenzoic acid. InChIKey: TXEZMHLAAZGJQX-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-cyano-2-fluoro-5-methylbenzoic acid |
| InChIKey | TXEZMHLAAZGJQX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C#N)F)C(=O)O |
Computed by PubChem (NCBI)