Products 1807179-22-1

CAS 1807179-22-1 is the registry number for 4-Cyano-5-hydroxy-2-methoxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyano-5-hydroxy-2-methoxybenzoic acid (CAS 1807179-22-1) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 4-cyano-5-hydroxy-2-methoxybenzoic acid. InChIKey: KLNGGJIWELXZCD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO4
Molecular weight193.16 g/mol
IUPAC name4-cyano-5-hydroxy-2-methoxybenzoic acid
InChIKeyKLNGGJIWELXZCD-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C#N)O)C(=O)O

Computed by PubChem (NCBI)