Products 1807182-52-0
CAS 1807182-52-0 is the registry number for 2,5-Dichloro-1-methyl-3-nitrobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,5-dichloro-1-methyl-3-nitrobenzene (CAS 1807182-52-0) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,5-dichloro-1-methyl-3-nitrobenzene. InChIKey: KSZGQODQPCMNNF-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,5-dichloro-1-methyl-3-nitrobenzene |
| InChIKey | KSZGQODQPCMNNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)