Products 1807209-00-2

CAS 1807209-00-2 is the registry number for 2-Bromo-3-cyano-4-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-bromo-3-cyano-4-methylbenzoic acid (CAS 1807209-00-2) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 2-bromo-3-cyano-4-methylbenzoic acid. InChIKey: JODSKBKSBHWYLT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO2
Molecular weight240.05 g/mol
IUPAC name2-bromo-3-cyano-4-methylbenzoic acid
InChIKeyJODSKBKSBHWYLT-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)C(=O)O)Br)C#N

Computed by PubChem (NCBI)