CAS 18087-11-1 is the registry number for 1-Methoxy-4,5-dimethyl-2-nitrobenzene. Offered by: TRC. Available pack sizes: 250mg.
1-methoxy-4,5-dimethyl-2-nitrobenzene (CAS 18087-11-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-methoxy-4,5-dimethyl-2-nitrobenzene. InChIKey: LPPBGAJFLLJXIR-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-methoxy-4,5-dimethyl-2-nitrobenzene |
| InChIKey | LPPBGAJFLLJXIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)