CAS 18160-82-2 appears in our catalog under these names: 3-Phenylisothiazole-4-carboxylic acid, 95+%, 3-Phenyl-1,2-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-phenyl-1,2-thiazole-4-carboxylic acid (CAS 18160-82-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 3-phenyl-1,2-thiazole-4-carboxylic acid. InChIKey: KPFIQSITWQLVSH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 3-phenyl-1,2-thiazole-4-carboxylic acid |
| InChIKey | KPFIQSITWQLVSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC=C2C(=O)O |
Computed by PubChem (NCBI)