Products 181765-30-0
CAS 181765-30-0 appears in our catalog under these names: PD 151746, 95.03%, PD 151746, 95.0%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10 mg, 5 mg, 25 mg, 50 mg, 10mM/1mL, 100 mg, 5mg, 10mg.
(Z)-3-(5-fluoro-1H-indol-3-yl)-2-sulfanylprop-2-enoic acid (CAS 181765-30-0) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: (Z)-3-(5-fluoro-1H-indol-3-yl)-2-sulfanylprop-2-enoic acid. InChIKey: HWMQHECFXSVZGN-KMKOMSMNSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (Z)-3-(5-fluoro-1H-indol-3-yl)-2-sulfanylprop-2-enoic acid |
| InChIKey | HWMQHECFXSVZGN-KMKOMSMNSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)/C=C(/C(=O)O)\S |
Computed by PubChem (NCBI)
Synonyms:
pd 151746, (Rac)-PD 151746, 3-(5-Fluoro-3-indolyl)-2-mercapto-2-propenoic Acid, (Z)-3-(5-Fluoro-1H-indol-3-yl)-2-mercaptoacrylic acid, (Z)-3-(5-fluoro-1H-indol-3-yl)-2-sulfanylprop-2-enoic acid, 3-(5-Fluoro-3-indolyl)-2-mercapto-(Z)-2-propenoic Acid, 3-(5-Fluoro-1H-indol-3-yl)-2-mercaptoacrylic acid, orb1225901, orb3173015, 3-(5-Fluoro-1H-indol-3-yl)-2-mercapto-2-propenoic Acid;