CAS 181772-16-7 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)hydrocinnamic acid, 95%, 3,5-Bis(trifluoromethyl)hydrocinnamic acid, 95%, 95%, 3-(3,5-Bis(trifluoromethyl)phenyl)propanoic acid, 95%, 3-(3,5-Bis(trifluoromethyl)phenyl)propanoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid (CAS 181772-16-7) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid. InChIKey: LISLXJGPJUAEHU-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | LISLXJGPJUAEHU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCC(=O)O |
Computed by PubChem (NCBI)