Products 95299-16-4
CAS 95299-16-4 is the registry number for 3,5-Bis(trifluoromethyl)phenyl acetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-[3,5-bis(trifluoromethyl)phenyl]acetate (CAS 95299-16-4) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: methyl 2-[3,5-bis(trifluoromethyl)phenyl]acetate. InChIKey: URDXSDHDNSBKHI-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]acetate |
| InChIKey | URDXSDHDNSBKHI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-[3,5-bis(trifluoromethyl)phenyl]acetate, methyl 2-(3,5-bis(trifluoromethyl)phenyl)acetate, Benzeneacetic acid, 3,5-bis(trifluoromethyl)-, methyl ester, Netupitant Impurity I, 3,5-Bis(trifluoromethyl)-benzeneacetic acid methyl ester, 3,5-Bis(trifluoromethyl)phenyl acetic acid methyl ester, Methyl 3,5-bis(trifluoromethyl)phenylacetate, Methyl 3,5-Bis(trifluoromethyl)benzeneacetate, 3,5-bis-trifluoromethylphenylacetic acid methyl ester, methyl 3,5-bis(triflouromethyl)phenylacetate