Products 38570-08-0
CAS 38570-08-0 is the registry number for Ethyl 2,6-bis(trifluoromethyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2,6-bis(trifluoromethyl)benzoate (CAS 38570-08-0) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: ethyl 2,6-bis(trifluoromethyl)benzoate. InChIKey: RFRCILWTRIADIM-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | ethyl 2,6-bis(trifluoromethyl)benzoate |
| InChIKey | RFRCILWTRIADIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)