CAS 731-00-0 is the registry number for 4,4,4-Trifluoro-3-hydroxy-3-(trifluoromethyl)butyrophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
4,4,4-trifluoro-3-hydroxy-1-phenyl-3-(trifluoromethyl)butan-1-one (CAS 731-00-0) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: 4,4,4-trifluoro-3-hydroxy-1-phenyl-3-(trifluoromethyl)butan-1-one. InChIKey: VRLJBWKYHRJXGK-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-hydroxy-1-phenyl-3-(trifluoromethyl)butan-1-one |
| InChIKey | VRLJBWKYHRJXGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)