CAS 289686-73-3 appears in our catalog under these names: 2-(3,5-Bis(trifluoromethyl)phenyl)propanoic acid, 98%, 2-(3,5-Bis(trifluoromethyl)phenyl)propanoic Acid, 2-(3,5-Bis(trifluoromethyl)phenyl)propanoic acid, 95%. Offered by: Chemat Brand, TRC, Fluorochem, Ambeed. Available pack sizes: on request, 750mg, 1g, 100mg, 250mg.
2-[3,5-bis(trifluoromethyl)phenyl]propanoic acid (CAS 289686-73-3) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]propanoic acid. InChIKey: SFSCZXRNLPFPTP-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | SFSCZXRNLPFPTP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)