CAS 302912-03-4 is the registry number for 2,5-Bis(trifluoromethyl)hydrocinnamic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-[2,5-bis(trifluoromethyl)phenyl]propanoic acid (CAS 302912-03-4) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: 3-[2,5-bis(trifluoromethyl)phenyl]propanoic acid. InChIKey: CHIXRVUEUZNLNI-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 3-[2,5-bis(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | CHIXRVUEUZNLNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)