Products 773135-00-5
CAS 773135-00-5 appears in our catalog under these names: Ethyl 2,4-bis(trifluoromethyl)benzoate, 95%, Ethyl 2,4-bis(trifluoromethyl)benzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
Ethyl 2,4-bis(trifluoromethyl)benzoate (CAS 773135-00-5) is a chemical compound with the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. IUPAC name: ethyl 2,4-bis(trifluoromethyl)benzoate. InChIKey: UWLACOVHZRHEIV-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O2 |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | ethyl 2,4-bis(trifluoromethyl)benzoate |
| InChIKey | UWLACOVHZRHEIV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)