CAS 1817793-19-3 is the registry number for Ethyl 2-oxo-1,2,5,6-tetrahydropyrimido[4,5-e]indolizine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-oxo-5,6-dihydro-1H-pyrimido[4,5-e]indolizine-7-carboxylate (CAS 1817793-19-3) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: ethyl 2-oxo-5,6-dihydro-1H-pyrimido[4,5-e]indolizine-7-carboxylate. InChIKey: QBKXFWMFTSYDSD-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | ethyl 2-oxo-5,6-dihydro-1H-pyrimido[4,5-e]indolizine-7-carboxylate |
| InChIKey | QBKXFWMFTSYDSD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2CCC3=C(N2C=C1)NC(=O)N=C3 |
Computed by PubChem (NCBI)