CAS 1820570-96-4 appears in our catalog under these names: (2S,4S)-4-Methoxy-2-(methoxymethyl)pyrrolidine hydrochloride, (2S,4S)-4-Methoxy-2-(methoxymethyl)pyrrolidine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride (CAS 1820570-96-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride. InChIKey: HNEUSESZADIYDX-LEUCUCNGSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride |
| InChIKey | HNEUSESZADIYDX-LEUCUCNGSA-N |
| SMILES | COC[C@@H]1C[C@@H](CN1)OC.Cl |
Computed by PubChem (NCBI)