Products 1820686-76-7
CAS 1820686-76-7 is the registry number for methyl 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylate (CAS 1820686-76-7) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: methyl 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylate. InChIKey: AUZKSCSIUFPFJC-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | methyl 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | AUZKSCSIUFPFJC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC=N1)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)