Products 1065074-55-6
CAS 1065074-55-6 is the registry number for Methyl 6,8-dichloro-4-oxo-1,4-dihydroquinoline-2-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 6,8-dichloro-4-oxo-1H-quinoline-2-carboxylate (CAS 1065074-55-6) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: methyl 6,8-dichloro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: GPHBMGYRXSTKML-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | methyl 6,8-dichloro-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | GPHBMGYRXSTKML-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)