Products 29236-13-3
CAS 29236-13-3 is the registry number for 3,4-Dichloro-1-(2-methoxyphenyl)-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,4-dichloro-1-(2-methoxyphenyl)pyrrole-2,5-dione (CAS 29236-13-3) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3,4-dichloro-1-(2-methoxyphenyl)pyrrole-2,5-dione. InChIKey: BZCLVZUUOCDZAQ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3,4-dichloro-1-(2-methoxyphenyl)pyrrole-2,5-dione |
| InChIKey | BZCLVZUUOCDZAQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)