CAS 4402-88-4 is the registry number for 3-(3,5-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 4402-88-4) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WMCPMRCFYXTUOH-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | WMCPMRCFYXTUOH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)