Products 4402-88-4

CAS 4402-88-4 is the registry number for 3-(3,5-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 4402-88-4) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WMCPMRCFYXTUOH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7Cl2NO3
Molecular weight272.08 g/mol
IUPAC name3-(3,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyWMCPMRCFYXTUOH-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC(=CC(=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)