Products 130613-19-3
CAS 130613-19-3 appears in our catalog under these names: Methyl 5,7-dichloro-4-hydroxyquinoline-2-carboxylate, 98%, Methyl 5,7-dichloro-4-hydroxyquinoline-2-carboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg.
Methyl 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate (CAS 130613-19-3) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: methyl 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: DNQDFGYHUHRIHR-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | methyl 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | DNQDFGYHUHRIHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)