Products 1820685-13-9
CAS 1820685-13-9 is the registry number for methyl 5,7-dichloro-4-hydroxyquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylate (CAS 1820685-13-9) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: methyl 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: UEDZAAPTBWNOSU-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | methyl 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | UEDZAAPTBWNOSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C(C1=O)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)