Products 4402-75-9
CAS 4402-75-9 appears in our catalog under these names: 3-(2,3-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid, 95%, 3-(2,3-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(2,3-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 4402-75-9) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: FXSFOUNJWRTJRZ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | FXSFOUNJWRTJRZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C(=CC=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)