CAS 3919-76-4 appears in our catalog under these names: 3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolylcarboxylic Acid, 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid, 95%, Dicloxacillin Impurity D, 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic Acid, 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid, 97% . Offered by: TRC, Combi-blocks, Chemat Brand, Mikromol, Thermo Scientific. Available pack sizes: 100mg, 1g, 500mg, 25g, 5g, on request, 25mg, 10g.
3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 3919-76-4) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WQXUUMUOERZZAE-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | WQXUUMUOERZZAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)