CAS 1821802-95-2 appears in our catalog under these names: rac-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid, trans, trans–2–(o–tolyl)cyclopropane–1–carboxylic acid. Offered by: Chemat, GLPBio. Available pack sizes: 500mg, 1g, 5g.
Trans-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid (CAS 1821802-95-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: trans-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: JLTWVSDENGCCEJ-VHSXEESVSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | JLTWVSDENGCCEJ-VHSXEESVSA-N |
| SMILES | CC1=CC=CC=C1[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)