CAS 705250-88-0 appears in our catalog under these names: rel-(1R,2R)-2-(o-Tolyl)cyclopropane-1-carboxylic acid, 95%, rac-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
Trans-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid (CAS 705250-88-0) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: trans-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: JLTWVSDENGCCEJ-VHSXEESVSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | JLTWVSDENGCCEJ-VHSXEESVSA-N |
| SMILES | CC1=CC=CC=C1[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)